C24H30N4O — CID 166617675
6-methyl-2-[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide (PubChem CID 166617675) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 6-methyl-2-[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide.
| Compound Name | 6-methyl-2-[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166617675 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 6-methyl-2-[(1R,2S,6R,9R)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(N)=O)c(N2C[C@@H]3C[C@H](C2)[C@@H]2CCC[C@H](c4ccccc4)N2C3)n1 |
| InChI | InChI=1S/C24H30N4O/c1-16-10-11-20(23(25)29)24(26-16)27-13-17-12-19(15-27)22-9-5-8-21(28(22)14-17)18-6-3-2-4-7-18/h2-4,6-7,10-11,17,19,21-22H,5,8-9,12-15H2,1H3,(H2,25,29)/t17-,19+,21+,22-/m0/s1 |
| InChIKey | GOQIVHCTPYXGAM-GWWHBBDRSA-N |
| XLogP | 3.54 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |