C19H23N3O — CID 166618457
[3-(dimethylamino)phenyl]-[3-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 166618457) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl]-[3-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [3-(dimethylamino)phenyl]-[3-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 166618457 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [3-(dimethylamino)phenyl]-[3-(pyridin-3-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | CN(C)c1cccc(C(=O)N2CCC(Cc3cccnc3)C2)c1 |
| InChI | InChI=1S/C19H23N3O/c1-21(2)18-7-3-6-17(12-18)19(23)22-10-8-16(14-22)11-15-5-4-9-20-13-15/h3-7,9,12-13,16H,8,10-11,14H2,1-2H3 |
| InChIKey | NMEDWIHURZYTHH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |