C22H28N4 — CID 166619226
(1R,2S,6R,9R)-11-(6-methylpyridazin-3-yl)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecane (PubChem CID 166619226) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is (1R,2S,6R,9R)-11-(6-methylpyridazin-3-yl)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecane.
| Compound Name | (1R,2S,6R,9R)-11-(6-methylpyridazin-3-yl)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 166619226 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1R,2S,6R,9R)-11-(6-methylpyridazin-3-yl)-6-phenyl-7,11-diazatricyclo[7.3.1.02,7]tridecane |
| SMILES | Cc1ccc(N2C[C@@H]3C[C@H](C2)[C@@H]2CCC[C@H](c4ccccc4)N2C3)nn1 |
| InChI | InChI=1S/C22H28N4/c1-16-10-11-22(24-23-16)25-13-17-12-19(15-25)21-9-5-8-20(26(21)14-17)18-6-3-2-4-7-18/h2-4,6-7,10-11,17,19-21H,5,8-9,12-15H2,1H3/t17-,19+,20+,21-/m0/s1 |
| InChIKey | SOUHRUMAUXMQJK-KCLUMXDGSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |