C22H29N5O — CID 166620103
6-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidin-4-amine (PubChem CID 166620103) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 6-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidin-4-amine.
| Compound Name | 6-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166620103 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 6-[(1R,2S,6R,9R)-6-(4-methoxyphenyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-11-yl]pyrimidin-4-amine |
| SMILES | COc1ccc([C@H]2CCC[C@H]3[C@@H]4C[C@@H](CN(c5cc(N)ncn5)C4)CN23)cc1 |
| InChI | InChI=1S/C22H29N5O/c1-28-18-7-5-16(6-8-18)19-3-2-4-20-17-9-15(12-27(19)20)11-26(13-17)22-10-21(23)24-14-25-22/h5-8,10,14-15,17,19-20H,2-4,9,11-13H2,1H3,(H2,23,24,25)/t15-,17+,19+,20-/m0/s1 |
| InChIKey | SVWQJPBNEYUNCP-ZSXHRAQDSA-N |
| XLogP | 3.12 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |