About tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate
tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate (PubChem CID 16662192) has the molecular formula C20H24N4O3S
and a molecular weight of 400.50 g/mol. Its IUPAC name is tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate |
| PubChem CID | 16662192 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate |
| SMILES | Cc1nc(C#Cc2cnc(OC3CCN(C(=O)OC(C)(C)C)CC3)nc2)cs1 |
| InChI | InChI=1S/C20H24N4O3S/c1-14-23-16(13-28-14)6-5-15-11-21-18(22-12-15)26-17-7-9-24(10-8-17)19(25)27-20(2,3)4/h11-13,17H,7-10H2,1-4H3 |
| InChIKey | TZVDRMCGZOUBHY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate (CID 16662192) is tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate is Cc1nc(C#Cc2cnc(OC3CCN(C(=O)OC(C)(C)C)CC3)nc2)cs1.
What is the InChIKey of tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate?
The InChIKey is TZVDRMCGZOUBHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O3S/c1-14-23-16(13-28-14)6-5-15-11-21-18(22-12-15)26-17-7-9-24(10-8-17)19(25)27-20(2,3)4/h11-13,17H,7-10H2,1-4H3.
What are the key properties of tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate?
tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate has a molecular weight of 400.50 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyrimidin-2-yl]oxypiperidine-1-carboxylate is sourced from PubChem (CID 16662192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).