About [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol
[3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol (PubChem CID 16662260) has the molecular formula C18H14N2OS
and a molecular weight of 306.39 g/mol. Its IUPAC name is [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol |
| PubChem CID | 16662260 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol |
| SMILES | Cc1nc(C#Cc2ccc(-c3cccc(CO)c3)nc2)cs1 |
| InChI | InChI=1S/C18H14N2OS/c1-13-20-17(12-22-13)7-5-14-6-8-18(19-10-14)16-4-2-3-15(9-16)11-21/h2-4,6,8-10,12,21H,11H2,1H3 |
| InChIKey | PNZDHXFKDFJGKB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol?
The IUPAC name of [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol (CID 16662260) is [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol.
What is the SMILES notation for [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol?
The canonical SMILES for [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol is Cc1nc(C#Cc2ccc(-c3cccc(CO)c3)nc2)cs1.
What is the InChIKey of [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol?
The InChIKey is PNZDHXFKDFJGKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2OS/c1-13-20-17(12-22-13)7-5-14-6-8-18(19-10-14)16-4-2-3-15(9-16)11-21/h2-4,6,8-10,12,21H,11H2,1H3.
What are the key properties of [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol?
[3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol has a molecular weight of 306.39 g/mol, XLogP of 3.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-2-pyridinyl]phenyl]methanol is sourced from PubChem (CID 16662260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).