C23H35N3O — CID 166623742
(3S,7R,8aS)-N-(3-azaspiro[5.5]undecan-9-yl)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine (PubChem CID 166623742) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is (3S,7R,8aS)-N-(3-azaspiro[5.5]undecan-9-yl)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine.
| Compound Name | (3S,7R,8aS)-N-(3-azaspiro[5.5]undecan-9-yl)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
|---|---|
| PubChem CID | 166623742 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | (3S,7R,8aS)-N-(3-azaspiro[5.5]undecan-9-yl)-3-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-amine |
| SMILES | c1ccc([C@H]2CN3C[C@H](NC4CCC5(CCNCC5)CC4)C[C@H]3CO2)cc1 |
| InChI | InChI=1S/C23H35N3O/c1-2-4-18(5-3-1)22-16-26-15-20(14-21(26)17-27-22)25-19-6-8-23(9-7-19)10-12-24-13-11-23/h1-5,19-22,24-25H,6-17H2/t20-,21+,22-/m1/s1 |
| InChIKey | AONJCNRZMONGBZ-BHIFYINESA-N |
| XLogP | 3.10 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |