C21H25NO5S — CID 166623860
methyl 4-methoxy-3-[[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methyl]benzoate (PubChem CID 166623860) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is methyl 4-methoxy-3-[[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methyl]benzoate.
| Compound Name | methyl 4-methoxy-3-[[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 166623860 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | methyl 4-methoxy-3-[[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(OC)c(CC2CCN(S(=O)(=O)c3ccc(C)cc3)C2)c1 |
| InChI | InChI=1S/C21H25NO5S/c1-15-4-7-19(8-5-15)28(24,25)22-11-10-16(14-22)12-18-13-17(21(23)27-3)6-9-20(18)26-2/h4-9,13,16H,10-12,14H2,1-3H3 |
| InChIKey | WVFALMKGIAHAPK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |