About [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol
[5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol (PubChem CID 166624600) has the molecular formula C12H12F3NO2
and a molecular weight of 259.23 g/mol. Its IUPAC name is [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol.
Molecular Properties
| Compound Name | [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol |
| PubChem CID | 166624600 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol |
| SMILES | COc1ccc2c(c1)cc(CO)n2CC(F)(F)F |
| InChI | InChI=1S/C12H12F3NO2/c1-18-10-2-3-11-8(5-10)4-9(6-17)16(11)7-12(13,14)15/h2-5,17H,6-7H2,1H3 |
| InChIKey | AHKWNBYSPRYIFW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol?
The IUPAC name of [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol (CID 166624600) is [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol.
What is the SMILES notation for [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol?
The canonical SMILES for [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol is COc1ccc2c(c1)cc(CO)n2CC(F)(F)F.
What is the InChIKey of [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol?
The InChIKey is AHKWNBYSPRYIFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO2/c1-18-10-2-3-11-8(5-10)4-9(6-17)16(11)7-12(13,14)15/h2-5,17H,6-7H2,1H3.
What are the key properties of [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol?
[5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol has a molecular weight of 259.23 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methoxy-1-(2,2,2-trifluoroethyl)indol-2-yl]methanol is sourced from PubChem (CID 166624600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).