C17H18F3N3O2S — CID 16662492
N-[(2S)-butan-2-yl]-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyridin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 16662492) has the molecular formula C17H18F3N3O2S and a molecular weight of 385.41 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyridin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2S)-butan-2-yl]-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyridin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 16662492 |
| Molecular Formula | C17H18F3N3O2S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[(2S)-butan-2-yl]-5-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]pyridin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@H](C)Nc1ccc(C#Cc2csc(C)n2)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H17N3S.C2HF3O2/c1-4-11(2)17-15-8-6-13(9-16-15)5-7-14-10-19-12(3)18-14;3-2(4,5)1(6)7/h6,8-11H,4H2,1-3H3,(H,16,17);(H,6,7)/t11-;/m0./s1 |
| InChIKey | NTZKMLJYMJCEOU-MERQFXBCSA-N |
| XLogP | 4.09 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|