C26H36N4O7 — CID 166625048
(2R,3R,4R,5S)-1-[[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-nitroanilino]methyl]phenyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 166625048) has the molecular formula C26H36N4O7 and a molecular weight of 516.60 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-nitroanilino]methyl]phenyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-nitroanilino]methyl]phenyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166625048 |
| Molecular Formula | C26H36N4O7 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | (2R,3R,4R,5S)-1-[[4-[[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-nitroanilino]methyl]phenyl]methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | C[C@@H]1CN(c2ccc(NCc3ccc(CN4C[C@H](O)[C@@H](O)[C@H](O)[C@H]4CO)cc3)c([N+](=O)[O-])c2)C[C@H](C)O1 |
| InChI | InChI=1S/C26H36N4O7/c1-16-11-28(12-17(2)37-16)20-7-8-21(22(9-20)30(35)36)27-10-18-3-5-19(6-4-18)13-29-14-24(32)26(34)25(33)23(29)15-31/h3-9,16-17,23-27,31-34H,10-15H2,1-2H3/t16-,17+,23-,24+,25-,26-/m1/s1 |
| InChIKey | JOGXSPCVKVNMOH-ROBXLRKYSA-N |
| XLogP | 1.08 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|