C24H32N4O7 — CID 166625083
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[3-[(4-morpholin-4-yl-2-nitroanilino)methyl]phenyl]methyl]piperidine-3,4,5-triol (PubChem CID 166625083) has the molecular formula C24H32N4O7 and a molecular weight of 488.54 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[3-[(4-morpholin-4-yl-2-nitroanilino)methyl]phenyl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[3-[(4-morpholin-4-yl-2-nitroanilino)methyl]phenyl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 166625083 |
| Molecular Formula | C24H32N4O7 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[3-[(4-morpholin-4-yl-2-nitroanilino)methyl]phenyl]methyl]piperidine-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cc(N2CCOCC2)ccc1NCc1cccc(CN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c1 |
| InChI | InChI=1S/C24H32N4O7/c29-15-21-23(31)24(32)22(30)14-27(21)13-17-3-1-2-16(10-17)12-25-19-5-4-18(11-20(19)28(33)34)26-6-8-35-9-7-26/h1-5,10-11,21-25,29-32H,6-9,12-15H2/t21-,22+,23-,24-/m1/s1 |
| InChIKey | PHNSFXOWQRZVGC-UEQSERJNSA-N |
| XLogP | 0.30 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|