C27H34N5O8PS — CID 166625319
propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate (PubChem CID 166625319) has the molecular formula C27H34N5O8PS and a molecular weight of 619.64 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 166625319 |
| Molecular Formula | C27H34N5O8PS |
| Molecular Weight | 619.64 g/mol |
| Exact Mass | 619.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-ethynyl-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]-4-methylsulfanylbutanoate |
| SMILES | C#C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(N[C@@H](CCSC)C(=O)OC(C)C)Oc2ccccc2)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C27H34N5O8PS/c1-5-27(35)22(33)21(39-26(27)32-13-11-19-23(28)29-16-30-24(19)32)15-37-41(36,40-18-9-7-6-8-10-18)31-20(12-14-42-4)25(34)38-17(2)3/h1,6-11,13,16-17,20-22,26,33,35H,12,14-15H2,2-4H3,(H,31,36)(H2,28,29,30)/t20-,21+,22+,26+,27+,41?/m0/s1 |
| InChIKey | JMYMNRUBYDRSTQ-OBDLRXRRSA-N |
| XLogP | 2.50 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.64 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|