C22H32ClN3O — CID 166625349
(10E)-4-methoxy-7,23,24-triazatricyclo[18.2.1.12,5]tetracosa-1(22),2,4,6,10,20-hexaene;hydrochloride (PubChem CID 166625349) has the molecular formula C22H32ClN3O and a molecular weight of 389.97 g/mol. Its IUPAC name is (10E)-4-methoxy-7,23,24-triazatricyclo[18.2.1.12,5]tetracosa-1(22),2,4,6,10,20-hexaene;hydrochloride.
| Compound Name | (10E)-4-methoxy-7,23,24-triazatricyclo[18.2.1.12,5]tetracosa-1(22),2,4,6,10,20-hexaene;hydrochloride |
|---|---|
| PubChem CID | 166625349 |
| Molecular Formula | C22H32ClN3O |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (10E)-4-methoxy-7,23,24-triazatricyclo[18.2.1.12,5]tetracosa-1(22),2,4,6,10,20-hexaene;hydrochloride |
| SMILES | COc1cc2[nH]c1/C=N\CC/C=C/CCCCCCCCc1ccc-2[nH]1.Cl |
| InChI | InChI=1S/C22H31N3O.ClH/c1-26-22-16-20-19-14-13-18(24-19)12-10-8-6-4-2-3-5-7-9-11-15-23-17-21(22)25-20;/h7,9,13-14,16-17,24-25H,2-6,8,10-12,15H2,1H3;1H/b9-7+,23-17-; |
| InChIKey | BSJFFJDPOIAACT-RDBOURLUSA-N |
| XLogP | 6.09 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|