C22H22NO6+ — CID 166625493
(1S)-10,24-dimethoxy-6,8,20,22-tetraoxa-14-azoniahexacyclo[12.11.0.03,12.04,9.017,25.019,23]pentacosa-3,9,11,13,17,19(23),24-heptaene (PubChem CID 166625493) has the molecular formula C22H22NO6+ and a molecular weight of 396.42 g/mol. Its IUPAC name is (1S)-10,24-dimethoxy-6,8,20,22-tetraoxa-14-azoniahexacyclo[12.11.0.03,12.04,9.017,25.019,23]pentacosa-3,9,11,13,17,19(23),24-heptaene.
| Compound Name | (1S)-10,24-dimethoxy-6,8,20,22-tetraoxa-14-azoniahexacyclo[12.11.0.03,12.04,9.017,25.019,23]pentacosa-3,9,11,13,17,19(23),24-heptaene |
|---|---|
| PubChem CID | 166625493 |
| Molecular Formula | C22H22NO6+ |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (1S)-10,24-dimethoxy-6,8,20,22-tetraoxa-14-azoniahexacyclo[12.11.0.03,12.04,9.017,25.019,23]pentacosa-3,9,11,13,17,19(23),24-heptaene |
| SMILES | COc1cc2c(c3c1OCOC3)C[C@H]1c3c(cc4c(c3OC)OCO4)CC[N+]1=C2 |
| InChI | InChI=1S/C22H22NO6/c1-24-17-6-13-8-23-4-3-12-5-18-21(29-11-27-18)22(25-2)19(12)16(23)7-14(13)15-9-26-10-28-20(15)17/h5-6,8,16H,3-4,7,9-11H2,1-2H3/q+1/t16-/m0/s1 |
| InChIKey | MBUPJYSOFAOZNS-INIZCTEOSA-N |
| XLogP | 2.58 |
| TPSA | 58.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|