C20H26ClN3O10P2 — CID 166625689
[[(1R,2R,3S,4R,5S)-4-[(4Z)-4-[(4-chlorophenyl)methoxyimino]-3-methyl-2-oxopyrimidin-1-yl]-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 166625689) has the molecular formula C20H26ClN3O10P2 and a molecular weight of 565.84 g/mol. Its IUPAC name is [[(1R,2R,3S,4R,5S)-4-[(4Z)-4-[(4-chlorophenyl)methoxyimino]-3-methyl-2-oxopyrimidin-1-yl]-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(1R,2R,3S,4R,5S)-4-[(4Z)-4-[(4-chlorophenyl)methoxyimino]-3-methyl-2-oxopyrimidin-1-yl]-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 166625689 |
| Molecular Formula | C20H26ClN3O10P2 |
| Molecular Weight | 565.84 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | [[(1R,2R,3S,4R,5S)-4-[(4Z)-4-[(4-chlorophenyl)methoxyimino]-3-methyl-2-oxopyrimidin-1-yl]-2,3-dihydroxy-1-bicyclo[3.1.0]hexanyl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Cn1c(=O)n([C@H]2[C@H](O)[C@H](O)[C@]3(COP(=O)(O)CP(=O)(O)O)C[C@H]23)cc/c1=N/OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClN3O10P2/c1-23-15(22-33-9-12-2-4-13(21)5-3-12)6-7-24(19(23)27)16-14-8-20(14,18(26)17(16)25)10-34-36(31,32)11-35(28,29)30/h2-7,14,16-18,25-26H,8-11H2,1H3,(H,31,32)(H2,28,29,30)/b22-15-/t14-,16-,17+,18+,20+/m1/s1 |
| InChIKey | WBQYKEFEBFZQAA-QMICWRQDSA-N |
| XLogP | 0.49 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.84 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|