About 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one
2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one (PubChem CID 166625899) has the molecular formula C15H14N2O2
and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one.
Molecular Properties
| Compound Name | 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one |
| PubChem CID | 166625899 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one |
| SMILES | Cc1cccc(C(=O)n2cc3c(n2)CCCC3=O)c1 |
| InChI | InChI=1S/C15H14N2O2/c1-10-4-2-5-11(8-10)15(19)17-9-12-13(16-17)6-3-7-14(12)18/h2,4-5,8-9H,3,6-7H2,1H3 |
| InChIKey | GUOXKUHQDKAZQD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one?
The IUPAC name of 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one (CID 166625899) is 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one.
What is the SMILES notation for 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one?
The canonical SMILES for 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one is Cc1cccc(C(=O)n2cc3c(n2)CCCC3=O)c1.
What is the InChIKey of 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one?
The InChIKey is GUOXKUHQDKAZQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c1-10-4-2-5-11(8-10)15(19)17-9-12-13(16-17)6-3-7-14(12)18/h2,4-5,8-9H,3,6-7H2,1H3.
What are the key properties of 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one?
2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one has a molecular weight of 254.29 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbenzoyl)-6,7-dihydro-5H-indazol-4-one is sourced from PubChem (CID 166625899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).