About 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile
4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile (PubChem CID 166625953) has the molecular formula C17H17N5O
and a molecular weight of 307.36 g/mol. Its IUPAC name is 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| PubChem CID | 166625953 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile |
| SMILES | COc1cccc(-c2c(C#N)c3c(N)nc(C)nc3n2C)c1C |
| InChI | InChI=1S/C17H17N5O/c1-9-11(6-5-7-13(9)23-4)15-12(8-18)14-16(19)20-10(2)21-17(14)22(15)3/h5-7H,1-4H3,(H2,19,20,21) |
| InChIKey | HMPUCAWWQYICEQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The IUPAC name of 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile (CID 166625953) is 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The canonical SMILES for 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile is COc1cccc(-c2c(C#N)c3c(N)nc(C)nc3n2C)c1C.
What is the InChIKey of 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile?
The InChIKey is HMPUCAWWQYICEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O/c1-9-11(6-5-7-13(9)23-4)15-12(8-18)14-16(19)20-10(2)21-17(14)22(15)3/h5-7H,1-4H3,(H2,19,20,21).
What are the key properties of 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile?
4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile has a molecular weight of 307.36 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-(3-methoxy-2-methylphenyl)-2,7-dimethylpyrrolo[2,3-d]pyrimidine-5-carbonitrile is sourced from PubChem (CID 166625953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).