C21H20F3NO2 — CID 166625964
(3R,3aS,4R,5S,7aR)-6,6-difluoro-4-[5-(3-fluorophenyl)-2-pyridinyl]-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one (PubChem CID 166625964) has the molecular formula C21H20F3NO2 and a molecular weight of 375.39 g/mol. Its IUPAC name is (3R,3aS,4R,5S,7aR)-6,6-difluoro-4-[5-(3-fluorophenyl)-2-pyridinyl]-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4R,5S,7aR)-6,6-difluoro-4-[5-(3-fluorophenyl)-2-pyridinyl]-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 166625964 |
| Molecular Formula | C21H20F3NO2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | (3R,3aS,4R,5S,7aR)-6,6-difluoro-4-[5-(3-fluorophenyl)-2-pyridinyl]-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2-benzofuran-1-one |
| SMILES | C[C@H]1OC(=O)[C@@H]2CC(F)(F)[C@@H](C)[C@H](c3ccc(-c4cccc(F)c4)cn3)[C@H]12 |
| InChI | InChI=1S/C21H20F3NO2/c1-11-18(19-12(2)27-20(26)16(19)9-21(11,23)24)17-7-6-14(10-25-17)13-4-3-5-15(22)8-13/h3-8,10-12,16,18-19H,9H2,1-2H3/t11-,12+,16+,18+,19+/m0/s1 |
| InChIKey | DNKBZUWGRJYQDV-PCKNYGHKSA-N |
| XLogP | 4.82 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |