About 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine
4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 166625976) has the molecular formula C22H19N3OS
and a molecular weight of 373.48 g/mol. Its IUPAC name is 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine |
| PubChem CID | 166625976 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Oc2ccccc2-c2csc(Nc3ccccn3)n2)c(C)c1 |
| InChI | InChI=1S/C22H19N3OS/c1-15-10-11-19(16(2)13-15)26-20-8-4-3-7-17(20)18-14-27-22(24-18)25-21-9-5-6-12-23-21/h3-14H,1-2H3,(H,23,24,25) |
| InChIKey | BPJVFZLPBSTNDN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine?
The IUPAC name of 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine (CID 166625976) is 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine?
The canonical SMILES for 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine is Cc1ccc(Oc2ccccc2-c2csc(Nc3ccccn3)n2)c(C)c1.
What is the InChIKey of 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine?
The InChIKey is BPJVFZLPBSTNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3OS/c1-15-10-11-19(16(2)13-15)26-20-8-4-3-7-17(20)18-14-27-22(24-18)25-21-9-5-6-12-23-21/h3-14H,1-2H3,(H,23,24,25).
What are the key properties of 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine?
4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine has a molecular weight of 373.48 g/mol, XLogP of 6.36, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-dimethylphenoxy)phenyl]-N-pyridin-2-yl-1,3-thiazol-2-amine is sourced from PubChem (CID 166625976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).