C26H27F3N4 — CID 166626033
1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]azetidine-3-carbonitrile (PubChem CID 166626033) has the molecular formula C26H27F3N4 and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]azetidine-3-carbonitrile.
| Compound Name | 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 166626033 |
| Molecular Formula | C26H27F3N4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]azetidine-3-carbonitrile |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N3CC(C#N)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C26H27F3N4/c1-15-8-19-18-6-4-5-7-22(18)31-24(19)25(33(15)14-26(2,3)29)23-20(27)9-17(10-21(23)28)32-12-16(11-30)13-32/h4-7,9-10,15-16,25,31H,8,12-14H2,1-3H3/t15-,25-/m1/s1 |
| InChIKey | YPBGOOHCEVJLME-SGANQWHYSA-N |
| XLogP | 5.49 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|