C27H28ClNO2 — CID 166626044
[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] 5-chloro-1H-indole-2-carboxylate (PubChem CID 166626044) has the molecular formula C27H28ClNO2 and a molecular weight of 433.98 g/mol. Its IUPAC name is [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] 5-chloro-1H-indole-2-carboxylate.
| Compound Name | [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] 5-chloro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 166626044 |
| Molecular Formula | C27H28ClNO2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenyl] 5-chloro-1H-indole-2-carboxylate |
| SMILES | C=C[C@@](C)(/C=C/c1ccc(OC(=O)c2cc3cc(Cl)ccc3[nH]2)cc1)CCC=C(C)C |
| InChI | InChI=1S/C27H28ClNO2/c1-5-27(4,15-6-7-19(2)3)16-14-20-8-11-23(12-9-20)31-26(30)25-18-21-17-22(28)10-13-24(21)29-25/h5,7-14,16-18,29H,1,6,15H2,2-4H3/b16-14+/t27-/m1/s1 |
| InChIKey | MZOBKELAOVRGKP-BKJWKRJESA-N |
| XLogP | 7.99 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|