C16H18F2O3 — CID 166626233
3-[1-(3,4-difluorophenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 166626233) has the molecular formula C16H18F2O3 and a molecular weight of 296.31 g/mol. Its IUPAC name is 3-[1-(3,4-difluorophenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-[1-(3,4-difluorophenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 166626233 |
| Molecular Formula | C16H18F2O3 |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[1-(3,4-difluorophenyl)ethenyl]-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | C=C(c1ccc(F)c(F)c1)C1COC2(CCCCC2)OO1 |
| InChI | InChI=1S/C16H18F2O3/c1-11(12-5-6-13(17)14(18)9-12)15-10-19-16(21-20-15)7-3-2-4-8-16/h5-6,9,15H,1-4,7-8,10H2 |
| InChIKey | FBUAQCOTIGOEDH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|