C20H30O2 — CID 166626315
(1R,2S,5S,7S,9S,10R,13S,15R)-5-ethenyl-2,5,15-trimethyltetracyclo[7.5.1.02,7.011,15]pentadec-11-ene-10,13-diol (PubChem CID 166626315) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,2S,5S,7S,9S,10R,13S,15R)-5-ethenyl-2,5,15-trimethyltetracyclo[7.5.1.02,7.011,15]pentadec-11-ene-10,13-diol.
| Compound Name | (1R,2S,5S,7S,9S,10R,13S,15R)-5-ethenyl-2,5,15-trimethyltetracyclo[7.5.1.02,7.011,15]pentadec-11-ene-10,13-diol |
|---|---|
| PubChem CID | 166626315 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,2S,5S,7S,9S,10R,13S,15R)-5-ethenyl-2,5,15-trimethyltetracyclo[7.5.1.02,7.011,15]pentadec-11-ene-10,13-diol |
| SMILES | C=C[C@@]1(C)CC[C@@]2(C)[C@@H](C[C@@H]3[C@@H](O)C4=C[C@@H](O)C[C@H]2[C@@]43C)C1 |
| InChI | InChI=1S/C20H30O2/c1-5-18(2)6-7-19(3)12(11-18)8-14-17(22)15-9-13(21)10-16(19)20(14,15)4/h5,9,12-14,16-17,21-22H,1,6-8,10-11H2,2-4H3/t12-,13+,14+,16+,17+,18-,19-,20+/m0/s1 |
| InChIKey | RGXAUBKBQYZZFG-XSUQBFJVSA-N |
| XLogP | 3.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|