C15H16F2O3 — CID 166626401
8-[1-(3,4-difluorophenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane (PubChem CID 166626401) has the molecular formula C15H16F2O3 and a molecular weight of 282.29 g/mol. Its IUPAC name is 8-[1-(3,4-difluorophenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | 8-[1-(3,4-difluorophenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 166626401 |
| Molecular Formula | C15H16F2O3 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 8-[1-(3,4-difluorophenyl)ethenyl]-6,7,10-trioxaspiro[4.5]decane |
| SMILES | C=C(c1ccc(F)c(F)c1)C1COC2(CCCC2)OO1 |
| InChI | InChI=1S/C15H16F2O3/c1-10(11-4-5-12(16)13(17)8-11)14-9-18-15(20-19-14)6-2-3-7-15/h4-5,8,14H,1-3,6-7,9H2 |
| InChIKey | KZGDLIODGHROKH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|