C32H34FN5O3 — CID 166626542
N-(2-aminophenyl)-7-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxy]heptanamide (PubChem CID 166626542) has the molecular formula C32H34FN5O3 and a molecular weight of 555.65 g/mol. Its IUPAC name is N-(2-aminophenyl)-7-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxy]heptanamide.
| Compound Name | N-(2-aminophenyl)-7-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxy]heptanamide |
|---|---|
| PubChem CID | 166626542 |
| Molecular Formula | C32H34FN5O3 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | N-(2-aminophenyl)-7-[(17-fluoro-21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15(20),16,18-heptaen-7-yl)oxy]heptanamide |
| SMILES | CN1c2ccc(F)cc2C(=O)N2CCc3c([nH]c4ccc(OCCCCCCC(=O)Nc5ccccc5N)cc34)C21 |
| InChI | InChI=1S/C32H34FN5O3/c1-37-28-14-11-20(33)18-24(28)32(40)38-16-15-22-23-19-21(12-13-26(23)36-30(22)31(37)38)41-17-7-3-2-4-10-29(39)35-27-9-6-5-8-25(27)34/h5-6,8-9,11-14,18-19,31,36H,2-4,7,10,15-17,34H2,1H3,(H,35,39) |
| InChIKey | NDBMIEDHAMWNTC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|