C26H26F9N7O — CID 166626561
(E)-1-[4-[5-[4-amino-3-[3,5-bis(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]-4,4,4-trifluorobut-2-en-1-one (PubChem CID 166626561) has the molecular formula C26H26F9N7O and a molecular weight of 623.52 g/mol. Its IUPAC name is (E)-1-[4-[5-[4-amino-3-[3,5-bis(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]-4,4,4-trifluorobut-2-en-1-one.
| Compound Name | (E)-1-[4-[5-[4-amino-3-[3,5-bis(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]-4,4,4-trifluorobut-2-en-1-one |
|---|---|
| PubChem CID | 166626561 |
| Molecular Formula | C26H26F9N7O |
| Molecular Weight | 623.52 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | (E)-1-[4-[5-[4-amino-3-[3,5-bis(trifluoromethyl)phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]pentyl]piperazin-1-yl]-4,4,4-trifluorobut-2-en-1-one |
| SMILES | Nc1ncnc2c1c(-c1cc(C(F)(F)F)cc(C(F)(F)F)c1)nn2CCCCCN1CCN(C(=O)/C=C/C(F)(F)F)CC1 |
| InChI | InChI=1S/C26H26F9N7O/c27-24(28,29)5-4-19(43)41-10-8-40(9-11-41)6-2-1-3-7-42-23-20(22(36)37-15-38-23)21(39-42)16-12-17(25(30,31)32)14-18(13-16)26(33,34)35/h4-5,12-15H,1-3,6-11H2,(H2,36,37,38)/b5-4+ |
| InChIKey | DPSDPDLIGHEHRB-SNAWJCMRSA-N |
| XLogP | 5.55 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|