C27H26N2O6 — CID 166626594
[(1S,3S,11S,12R,13R,15R,16R,19S)-8,19-dimethyl-6,18-dioxo-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-4,7,9-trien-3-yl] 3-(3-but-3-ynyldiazirin-3-yl)propanoate (PubChem CID 166626594) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is [(1S,3S,11S,12R,13R,15R,16R,19S)-8,19-dimethyl-6,18-dioxo-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-4,7,9-trien-3-yl] 3-(3-but-3-ynyldiazirin-3-yl)propanoate.
| Compound Name | [(1S,3S,11S,12R,13R,15R,16R,19S)-8,19-dimethyl-6,18-dioxo-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-4,7,9-trien-3-yl] 3-(3-but-3-ynyldiazirin-3-yl)propanoate |
|---|---|
| PubChem CID | 166626594 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [(1S,3S,11S,12R,13R,15R,16R,19S)-8,19-dimethyl-6,18-dioxo-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-4,7,9-trien-3-yl] 3-(3-but-3-ynyldiazirin-3-yl)propanoate |
| SMILES | C#CCCC1(CCC(=O)O[C@H]2C[C@]34C(=O)O[C@H]5[C@H](O[C@H]6c7c(C)cc(=O)cc2c7[C@@H]3[C@@H]56)[C@H]4C)N=N1 |
| InChI | InChI=1S/C27H26N2O6/c1-4-5-7-26(28-29-26)8-6-17(31)33-16-11-27-13(3)22-24(35-25(27)32)20-21(27)19-15(16)10-14(30)9-12(2)18(19)23(20)34-22/h1,9-10,13,16,20-24H,5-8,11H2,2-3H3/t13-,16+,20-,21-,22-,23+,24-,27-/m1/s1 |
| InChIKey | SUWUZRWMMFEQHO-BVANDFLFSA-N |
| XLogP | 3.41 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|