C32H36N6O2 — CID 166626600
11,12-dimethoxy-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline (PubChem CID 166626600) has the molecular formula C32H36N6O2 and a molecular weight of 536.68 g/mol. Its IUPAC name is 11,12-dimethoxy-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline.
| Compound Name | 11,12-dimethoxy-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline |
|---|---|
| PubChem CID | 166626600 |
| Molecular Formula | C32H36N6O2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 11,12-dimethoxy-3,6-bis(4-methylpiperazin-1-yl)phenanthro[9,10-b]quinoxaline |
| SMILES | COc1cc2nc3c4ccc(N5CCN(C)CC5)cc4c4cc(N5CCN(C)CC5)ccc4c3nc2cc1OC |
| InChI | InChI=1S/C32H36N6O2/c1-35-9-13-37(14-10-35)21-5-7-23-25(17-21)26-18-22(38-15-11-36(2)12-16-38)6-8-24(26)32-31(23)33-27-19-29(39-3)30(40-4)20-28(27)34-32/h5-8,17-20H,9-16H2,1-4H3 |
| InChIKey | YZDDIPOAAJPPLG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|