About [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate
[(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate (PubChem CID 166626622) has the molecular formula C24H28N2O2
and a molecular weight of 376.50 g/mol. Its IUPAC name is [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate.
Molecular Properties
| Compound Name | [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate |
| PubChem CID | 166626622 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate |
| SMILES | C=C1[C@@H]2CCC[C@@]1(COC(=O)c1ccccc1-c1ccccn1)CN(CC)C2 |
| InChI | InChI=1S/C24H28N2O2/c1-3-26-15-19-9-8-13-24(16-26,18(19)2)17-28-23(27)21-11-5-4-10-20(21)22-12-6-7-14-25-22/h4-7,10-12,14,19H,2-3,8-9,13,15-17H2,1H3/t19-,24+/m1/s1 |
| InChIKey | OEGRZDYKBXWJKY-DVECYGJZSA-N |
| XLogP | 4.58 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate?
The IUPAC name of [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate (CID 166626622) is [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate.
What is the SMILES notation for [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate?
The canonical SMILES for [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate is C=C1[C@@H]2CCC[C@@]1(COC(=O)c1ccccc1-c1ccccn1)CN(CC)C2.
What is the InChIKey of [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate?
The InChIKey is OEGRZDYKBXWJKY-DVECYGJZSA-N. The full InChI is InChI=1S/C24H28N2O2/c1-3-26-15-19-9-8-13-24(16-26,18(19)2)17-28-23(27)21-11-5-4-10-20(21)22-12-6-7-14-25-22/h4-7,10-12,14,19H,2-3,8-9,13,15-17H2,1H3/t19-,24+/m1/s1.
What are the key properties of [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate?
[(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate has a molecular weight of 376.50 g/mol, XLogP of 4.58, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5S)-3-ethyl-9-methylidene-3-azabicyclo[3.3.1]nonan-1-yl]methyl 2-pyridin-2-ylbenzoate is sourced from PubChem (CID 166626622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).