C40H42N4O4 — CID 166626641
N-[4-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]butyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide (PubChem CID 166626641) has the molecular formula C40H42N4O4 and a molecular weight of 642.80 g/mol. Its IUPAC name is N-[4-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]butyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide.
| Compound Name | N-[4-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]butyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 166626641 |
| Molecular Formula | C40H42N4O4 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | N-[4-[[(E)-3-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]prop-2-enoyl]amino]butyl]-3-(6-methoxy-1H-benzimidazol-2-yl)propanamide |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(/C=C/C(=O)NCCCCNC(=O)CCc2nc3ccc(OC)cc3[nH]2)cc1)c1ccccc1 |
| InChI | InChI=1S/C40H42N4O4/c1-3-34(29-9-5-4-6-10-29)40(31-16-18-32(45)19-17-31)30-14-11-28(12-15-30)13-23-38(46)41-25-7-8-26-42-39(47)24-22-37-43-35-21-20-33(48-2)27-36(35)44-37/h4-6,9-21,23,27,45H,3,7-8,22,24-26H2,1-2H3,(H,41,46)(H,42,47)(H,43,44)/b23-13+,40-34? |
| InChIKey | IARNTHMXUOQDQU-XVJUZEHKSA-N |
| XLogP | 7.30 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|