C23H30N2O2S — CID 166626793
N-(1,3-dihydrothieno[3,4-c]furan-4-ylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine (PubChem CID 166626793) has the molecular formula C23H30N2O2S and a molecular weight of 398.57 g/mol. Its IUPAC name is N-(1,3-dihydrothieno[3,4-c]furan-4-ylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine.
| Compound Name | N-(1,3-dihydrothieno[3,4-c]furan-4-ylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine |
|---|---|
| PubChem CID | 166626793 |
| Molecular Formula | C23H30N2O2S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-(1,3-dihydrothieno[3,4-c]furan-4-ylmethyl)-2-[(9R)-9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl]ethanamine |
| SMILES | c1ccc([C@]2(CCNCc3scc4c3COC4)CCOC3(CCCC3)C2)nc1 |
| InChI | InChI=1S/C23H30N2O2S/c1-4-10-25-21(5-1)22(9-12-27-23(17-22)6-2-3-7-23)8-11-24-13-20-19-15-26-14-18(19)16-28-20/h1,4-5,10,16,24H,2-3,6-9,11-15,17H2/t22-/m1/s1 |
| InChIKey | NPDJGFAEJDZABQ-JOCHJYFZSA-N |
| XLogP | 4.71 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|