C26H29N5O3 — CID 16662687
benzyl (2S,5R)-4-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,5-dimethylpiperazine-1-carboxylate (PubChem CID 16662687) has the molecular formula C26H29N5O3 and a molecular weight of 459.55 g/mol. Its IUPAC name is benzyl (2S,5R)-4-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,5-dimethylpiperazine-1-carboxylate.
| Compound Name | benzyl (2S,5R)-4-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,5-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 16662687 |
| Molecular Formula | C26H29N5O3 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | benzyl (2S,5R)-4-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,5-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OCc2ccccc2)[C@@H](C)CN1c1ccc(C(=O)Nc2ccccc2N)cn1 |
| InChI | InChI=1S/C26H29N5O3/c1-18-16-31(26(33)34-17-20-8-4-3-5-9-20)19(2)15-30(18)24-13-12-21(14-28-24)25(32)29-23-11-7-6-10-22(23)27/h3-14,18-19H,15-17,27H2,1-2H3,(H,29,32)/t18-,19+/m1/s1 |
| InChIKey | VQMYVDSNYDTMBL-MOPGFXCFSA-N |
| XLogP | 4.15 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|