C27H33F3N4 — CID 166626892
1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-N,N-dimethylazetidin-3-amine (PubChem CID 166626892) has the molecular formula C27H33F3N4 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-N,N-dimethylazetidin-3-amine.
| Compound Name | 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-N,N-dimethylazetidin-3-amine |
|---|---|
| PubChem CID | 166626892 |
| Molecular Formula | C27H33F3N4 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 1-[3,5-difluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-N,N-dimethylazetidin-3-amine |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2c(F)cc(N3CC(N(C)C)C3)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C27H33F3N4/c1-16-10-20-19-8-6-7-9-23(19)31-25(20)26(34(16)15-27(2,3)30)24-21(28)11-17(12-22(24)29)33-13-18(14-33)32(4)5/h6-9,11-12,16,18,26,31H,10,13-15H2,1-5H3/t16-,26-/m1/s1 |
| InChIKey | WJDAHKFBNSZJKZ-AKJBCIBTSA-N |
| XLogP | 5.28 |
| TPSA | 25.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|