C25H38O5 — CID 166627005
[(1S,2R,3S,4R,6R,7R,8R,14R)-3-acetyloxy-4-ethyl-2,4,7,14-tetramethyl-10-methylidene-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] acetate (PubChem CID 166627005) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is [(1S,2R,3S,4R,6R,7R,8R,14R)-3-acetyloxy-4-ethyl-2,4,7,14-tetramethyl-10-methylidene-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] acetate.
| Compound Name | [(1S,2R,3S,4R,6R,7R,8R,14R)-3-acetyloxy-4-ethyl-2,4,7,14-tetramethyl-10-methylidene-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] acetate |
|---|---|
| PubChem CID | 166627005 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [(1S,2R,3S,4R,6R,7R,8R,14R)-3-acetyloxy-4-ethyl-2,4,7,14-tetramethyl-10-methylidene-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] acetate |
| SMILES | C=C1C[C@]23CC[C@@H](C)[C@](C)([C@@H]2C1=O)[C@H](OC(C)=O)C[C@@](C)(CC)[C@@H](OC(C)=O)[C@@H]3C |
| InChI | InChI=1S/C25H38O5/c1-9-23(7)13-19(29-17(5)26)24(8)15(3)10-11-25(12-14(2)20(28)21(24)25)16(4)22(23)30-18(6)27/h15-16,19,21-22H,2,9-13H2,1,3-8H3/t15-,16+,19-,21+,22+,23-,24+,25+/m1/s1 |
| InChIKey | VYTWDRSIMJYOMO-RMGYSSOASA-N |
| XLogP | 4.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|