C24H22N2O7 — CID 166627049
[(1S,13S,15S,16S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,17-tetraen-16-yl] 3-nitrobenzoate (PubChem CID 166627049) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is [(1S,13S,15S,16S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,17-tetraen-16-yl] 3-nitrobenzoate.
| Compound Name | [(1S,13S,15S,16S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,17-tetraen-16-yl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 166627049 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [(1S,13S,15S,16S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,17-tetraen-16-yl] 3-nitrobenzoate |
| SMILES | CO[C@H]1C[C@H]2C(=C[C@@H]1OC(=O)c1cccc([N+](=O)[O-])c1)[C@H]1CN2Cc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C24H22N2O7/c1-30-20-9-19-17(8-23(20)33-24(27)13-3-2-4-15(5-13)26(28)29)18-11-25(19)10-14-6-21-22(7-16(14)18)32-12-31-21/h2-8,18-20,23H,9-12H2,1H3/t18-,19-,20-,23-/m0/s1 |
| InChIKey | KBXPJSHCOSLGKK-MXBUBSDBSA-N |
| XLogP | 3.18 |
| TPSA | 100.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|