C24H36N4O4 — CID 166627141
(6S,9S,13S)-4-benzyl-9,13-dimethyl-6-(2-methylpropyl)-1,4,7,10-tetrazacyclopentadecane-2,5,8,11-tetrone (PubChem CID 166627141) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is (6S,9S,13S)-4-benzyl-9,13-dimethyl-6-(2-methylpropyl)-1,4,7,10-tetrazacyclopentadecane-2,5,8,11-tetrone.
| Compound Name | (6S,9S,13S)-4-benzyl-9,13-dimethyl-6-(2-methylpropyl)-1,4,7,10-tetrazacyclopentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 166627141 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (6S,9S,13S)-4-benzyl-9,13-dimethyl-6-(2-methylpropyl)-1,4,7,10-tetrazacyclopentadecane-2,5,8,11-tetrone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](C)NC(=O)C[C@@H](C)CCNC(=O)CN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H36N4O4/c1-16(2)12-20-24(32)28(14-19-8-6-5-7-9-19)15-22(30)25-11-10-17(3)13-21(29)26-18(4)23(31)27-20/h5-9,16-18,20H,10-15H2,1-4H3,(H,25,30)(H,26,29)(H,27,31)/t17-,18-,20-/m0/s1 |
| InChIKey | VLWUKBXKZGMTBP-BJLQDIEVSA-N |
| XLogP | 1.60 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |