C20H24ClN5O4 — CID 166627483
5-N-(3-chlorophenyl)-3-N-methyl-3-N-(oxan-3-yloxy)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide (PubChem CID 166627483) has the molecular formula C20H24ClN5O4 and a molecular weight of 433.90 g/mol. Its IUPAC name is 5-N-(3-chlorophenyl)-3-N-methyl-3-N-(oxan-3-yloxy)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(3-chlorophenyl)-3-N-methyl-3-N-(oxan-3-yloxy)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 166627483 |
| Molecular Formula | C20H24ClN5O4 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 5-N-(3-chlorophenyl)-3-N-methyl-3-N-(oxan-3-yloxy)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
| SMILES | CN(OC1CCCOC1)C(=O)c1n[nH]c2c1CN(C(=O)Nc1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C20H24ClN5O4/c1-25(30-15-6-3-9-29-12-15)19(27)18-16-11-26(8-7-17(16)23-24-18)20(28)22-14-5-2-4-13(21)10-14/h2,4-5,10,15H,3,6-9,11-12H2,1H3,(H,22,28)(H,23,24) |
| InChIKey | DRPDXAYOJDMJFN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|