C31H58N3O+ — CID 166627509
4-(dimethylamino)butyl-dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azanium (PubChem CID 166627509) has the molecular formula C31H58N3O+ and a molecular weight of 488.83 g/mol. Its IUPAC name is 4-(dimethylamino)butyl-dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azanium.
| Compound Name | 4-(dimethylamino)butyl-dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 166627509 |
| Molecular Formula | C31H58N3O+ |
| Molecular Weight | 488.83 g/mol |
| Exact Mass | 488.46 |
| IUPAC Name | 4-(dimethylamino)butyl-dimethyl-[3-[[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoyl]amino]propyl]azanium |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)NCCC[N+](C)(C)CCCCN(C)C |
| InChI | InChI=1S/C31H57N3O/c1-27(2)16-12-17-28(3)18-13-19-29(4)20-14-21-30(5)26-31(35)32-22-15-25-34(8,9)24-11-10-23-33(6)7/h16,18,20,26H,10-15,17,19,21-25H2,1-9H3/p+1/b28-18+,29-20+,30-26+ |
| InChIKey | KRCJDWJNMXFPDE-LHJYKZFFSA-O |
| XLogP | 7.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.83 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|