About 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol
2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol (PubChem CID 166627514) has the molecular formula C23H22N2O5
and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol.
Molecular Properties
| Compound Name | 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol |
| PubChem CID | 166627514 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol |
| SMILES | COc1ccc(-c2ccc3ncn(-c4cc(OC)c(OC)c(OC)c4)c3c2)cc1O |
| InChI | InChI=1S/C23H22N2O5/c1-27-20-8-6-15(10-19(20)26)14-5-7-17-18(9-14)25(13-24-17)16-11-21(28-2)23(30-4)22(12-16)29-3/h5-13,26H,1-4H3 |
| InChIKey | DZSBSJOFTCFGSQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol?
The IUPAC name of 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol (CID 166627514) is 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol.
What is the SMILES notation for 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol?
The canonical SMILES for 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol is COc1ccc(-c2ccc3ncn(-c4cc(OC)c(OC)c(OC)c4)c3c2)cc1O.
What is the InChIKey of 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol?
The InChIKey is DZSBSJOFTCFGSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O5/c1-27-20-8-6-15(10-19(20)26)14-5-7-17-18(9-14)25(13-24-17)16-11-21(28-2)23(30-4)22(12-16)29-3/h5-13,26H,1-4H3.
What are the key properties of 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol?
2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol has a molecular weight of 406.44 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]phenol is sourced from PubChem (CID 166627514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).