C28H29F3N4O2 — CID 166627566
1-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 166627566) has the molecular formula C28H29F3N4O2 and a molecular weight of 510.56 g/mol. Its IUPAC name is 1-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 166627566 |
| Molecular Formula | C28H29F3N4O2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 1-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@@H](NC(=O)Nc1ccccc1C(F)(F)F)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C28H29F3N4O2/c1-3-17-16-35-13-11-18(17)14-25(35)26(20-10-12-32-23-9-8-19(37-2)15-21(20)23)34-27(36)33-24-7-5-4-6-22(24)28(29,30)31/h3-10,12,15,17-18,25-26H,1,11,13-14,16H2,2H3,(H2,33,34,36)/t17?,18?,25-,26-/m0/s1 |
| InChIKey | BVSIVXAZQLFFHH-NLRAZLJFSA-N |
| XLogP | 6.02 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|