C29H37BrO4 — CID 166627617
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] 4-bromo-2-methylbenzoate (PubChem CID 166627617) has the molecular formula C29H37BrO4 and a molecular weight of 529.52 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] 4-bromo-2-methylbenzoate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] 4-bromo-2-methylbenzoate |
|---|---|
| PubChem CID | 166627617 |
| Molecular Formula | C29H37BrO4 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-6-hydroxy-2,4,7,14-tetramethyl-10-methylidene-9-oxo-3-tricyclo[5.4.3.01,8]tetradecanyl] 4-bromo-2-methylbenzoate |
| SMILES | C=C[C@]1(C)C[C@@H](O)[C@]2(C)[C@H](C)CC[C@]3(CC(=C)C(=O)[C@H]32)[C@@H](C)[C@@H]1OC(=O)c1ccc(Br)cc1C |
| InChI | InChI=1S/C29H37BrO4/c1-8-27(6)15-22(31)28(7)18(4)11-12-29(14-17(3)23(32)24(28)29)19(5)25(27)34-26(33)21-10-9-20(30)13-16(21)2/h8-10,13,18-19,22,24-25,31H,1,3,11-12,14-15H2,2,4-7H3/t18-,19+,22-,24+,25+,27-,28+,29+/m1/s1 |
| InChIKey | IIWKQJJTGRCIAG-NSXXYBCKSA-N |
| XLogP | 6.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|