About 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol
4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 166627647) has the molecular formula C16H23N5O
and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol |
| PubChem CID | 166627647 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | Cc1cc(NC2CCC(O)CC2)nc(-n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C16H23N5O/c1-10-9-15(18-13-4-6-14(22)7-5-13)19-16(17-10)21-12(3)8-11(2)20-21/h8-9,13-14,22H,4-7H2,1-3H3,(H,17,18,19) |
| InChIKey | PYSDPLYCBSWWCT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol?
The IUPAC name of 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol (CID 166627647) is 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol?
The canonical SMILES for 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol is Cc1cc(NC2CCC(O)CC2)nc(-n2nc(C)cc2C)n1.
What is the InChIKey of 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol?
The InChIKey is PYSDPLYCBSWWCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O/c1-10-9-15(18-13-4-6-14(22)7-5-13)19-16(17-10)21-12(3)8-11(2)20-21/h8-9,13-14,22H,4-7H2,1-3H3,(H,17,18,19).
What are the key properties of 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol?
4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol has a molecular weight of 301.39 g/mol, XLogP of 2.30, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,5-dimethylpyrazol-1-yl)-6-methylpyrimidin-4-yl]amino]cyclohexan-1-ol is sourced from PubChem (CID 166627647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).