C32H42O4 — CID 166627650
1-adamantyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate (PubChem CID 166627650) has the molecular formula C32H42O4 and a molecular weight of 490.68 g/mol. Its IUPAC name is 1-adamantyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate.
| Compound Name | 1-adamantyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate |
|---|---|
| PubChem CID | 166627650 |
| Molecular Formula | C32H42O4 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | 1-adamantyl (E,4S)-4-[(1S,3R,6R,7S,9E,11R)-10-formyl-3,14-dimethyl-12-oxo-6-tricyclo[9.3.0.03,7]tetradeca-9,13-dienyl]pent-2-enoate |
| SMILES | CC1=CC(=O)[C@H]2/C(C=O)=C\C[C@H]3[C@@H]([C@@H](C)/C=C/C(=O)OC45CC6CC(CC(C6)C4)C5)CC[C@]3(C)C[C@H]12 |
| InChI | InChI=1S/C32H42O4/c1-19(4-7-29(35)36-32-14-21-11-22(15-32)13-23(12-21)16-32)25-8-9-31(3)17-26-20(2)10-28(34)30(26)24(18-33)5-6-27(25)31/h4-5,7,10,18-19,21-23,25-27,30H,6,8-9,11-17H2,1-3H3/b7-4+,24-5-/t19-,21?,22?,23?,25+,26+,27-,30-,31+,32?/m0/s1 |
| InChIKey | BHJCSDGCGYAIKX-MHJCPZBXSA-N |
| XLogP | 6.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|