C27H23FN6O2 — CID 166627709
(1S,2S,3R,4R)-3-[[5-(3-fluorophenyl)-2-[4-(1,3-oxazol-5-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 166627709) has the molecular formula C27H23FN6O2 and a molecular weight of 482.52 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[5-(3-fluorophenyl)-2-[4-(1,3-oxazol-5-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4R)-3-[[5-(3-fluorophenyl)-2-[4-(1,3-oxazol-5-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 166627709 |
| Molecular Formula | C27H23FN6O2 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[5-(3-fluorophenyl)-2-[4-(1,3-oxazol-5-yl)anilino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)[C@@H]1[C@H](Nc2nc(Nc3ccc(-c4cnco4)cc3)ncc2-c2cccc(F)c2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C27H23FN6O2/c28-19-3-1-2-16(11-19)21-12-31-27(32-20-8-6-15(7-9-20)22-13-30-14-36-22)34-26(21)33-24-18-5-4-17(10-18)23(24)25(29)35/h1-9,11-14,17-18,23-24H,10H2,(H2,29,35)(H2,31,32,33,34)/t17-,18+,23+,24-/m1/s1 |
| InChIKey | KEAPLOABAMRRFQ-HJOCRKTISA-N |
| XLogP | 4.77 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|