C28H39F2N5 — CID 166627789
N-(4,4-difluorocyclohexyl)-N'-[[(7R)-5,6,7,8-tetrahydro-1,6-naphthyridin-7-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine (PubChem CID 166627789) has the molecular formula C28H39F2N5 and a molecular weight of 483.65 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-N'-[[(7R)-5,6,7,8-tetrahydro-1,6-naphthyridin-7-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine.
| Compound Name | N-(4,4-difluorocyclohexyl)-N'-[[(7R)-5,6,7,8-tetrahydro-1,6-naphthyridin-7-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 166627789 |
| Molecular Formula | C28H39F2N5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-N'-[[(7R)-5,6,7,8-tetrahydro-1,6-naphthyridin-7-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
| SMILES | FC1(F)CCC(NCCCCN(C[C@H]2Cc3ncccc3CN2)[C@H]2CCCc3cccnc32)CC1 |
| InChI | InChI=1S/C28H39F2N5/c29-28(30)12-10-23(11-13-28)31-14-1-2-17-35(26-9-3-6-21-7-4-16-33-27(21)26)20-24-18-25-22(19-34-24)8-5-15-32-25/h4-5,7-8,15-16,23-24,26,31,34H,1-3,6,9-14,17-20H2/t24-,26+/m1/s1 |
| InChIKey | ZHQDIVFVUGRKLD-RSXGOPAZSA-N |
| XLogP | 4.82 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|