About 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol
2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol (PubChem CID 166627809) has the molecular formula C25H20N2O
and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol |
| PubChem CID | 166627809 |
| Molecular Formula | C25H20N2O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol |
| SMILES | Nc1ccc2c(c1)CCc1c(-c3ccccc3)cc(-c3ccccc3O)nc1-2 |
| InChI | InChI=1S/C25H20N2O/c26-18-11-13-19-17(14-18)10-12-20-22(16-6-2-1-3-7-16)15-23(27-25(19)20)21-8-4-5-9-24(21)28/h1-9,11,13-15,28H,10,12,26H2 |
| InChIKey | PDOAIZSRVWGHJO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol?
The IUPAC name of 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol (CID 166627809) is 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol.
What is the SMILES notation for 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol?
The canonical SMILES for 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol is Nc1ccc2c(c1)CCc1c(-c3ccccc3)cc(-c3ccccc3O)nc1-2.
What is the InChIKey of 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol?
The InChIKey is PDOAIZSRVWGHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O/c26-18-11-13-19-17(14-18)10-12-20-22(16-6-2-1-3-7-16)15-23(27-25(19)20)21-8-4-5-9-24(21)28/h1-9,11,13-15,28H,10,12,26H2.
What are the key properties of 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol?
2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol has a molecular weight of 364.45 g/mol, XLogP of 5.47, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-amino-4-phenyl-5,6-dihydrobenzo[h]quinolin-2-yl)phenol is sourced from PubChem (CID 166627809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).