About [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene
[[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene (PubChem CID 166627900) has the molecular formula C18H19O3P
and a molecular weight of 314.32 g/mol. Its IUPAC name is [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene.
Molecular Properties
| Compound Name | [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene |
| PubChem CID | 166627900 |
| Molecular Formula | C18H19O3P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene |
| SMILES | CC(C)=C/C=C/P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H19O3P/c1-16(2)10-9-15-22(19,20-17-11-5-3-6-12-17)21-18-13-7-4-8-14-18/h3-15H,1-2H3/b15-9+ |
| InChIKey | SAQYSLYXDCYUPO-OQLLNIDSSA-N |
| XLogP | 5.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene?
The IUPAC name of [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene (CID 166627900) is [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene.
What is the SMILES notation for [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene?
The canonical SMILES for [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene is CC(C)=C/C=C/P(=O)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene?
The InChIKey is SAQYSLYXDCYUPO-OQLLNIDSSA-N. The full InChI is InChI=1S/C18H19O3P/c1-16(2)10-9-15-22(19,20-17-11-5-3-6-12-17)21-18-13-7-4-8-14-18/h3-15H,1-2H3/b15-9+.
What are the key properties of [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene?
[[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene has a molecular weight of 314.32 g/mol, XLogP of 5.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(1E)-4-methylpenta-1,3-dienyl]-phenoxyphosphoryl]oxybenzene is sourced from PubChem (CID 166627900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).