C27H39N3O7 — CID 166628032
[(Z)-4-[[(2S)-2-[[(2Z,4Z,6E,8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]but-3-enyl] carbamate (PubChem CID 166628032) has the molecular formula C27H39N3O7 and a molecular weight of 517.62 g/mol. Its IUPAC name is [(Z)-4-[[(2S)-2-[[(2Z,4Z,6E,8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]but-3-enyl] carbamate.
| Compound Name | [(Z)-4-[[(2S)-2-[[(2Z,4Z,6E,8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]but-3-enyl] carbamate |
|---|---|
| PubChem CID | 166628032 |
| Molecular Formula | C27H39N3O7 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | [(Z)-4-[[(2S)-2-[[(2Z,4Z,6E,8S)-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienoyl]amino]-3,3-dimethylbutanoyl]amino]but-3-enyl] carbamate |
| SMILES | COC1=CC[C@@H]([C@@H](C)/C=C(C)/C=C\C=C/C(=O)N[C@H](C(=O)N/C=C\CCOC(N)=O)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C27H39N3O7/c1-18(17-19(2)20-13-14-21(35-6)25(33)37-20)11-7-8-12-22(31)30-23(27(3,4)5)24(32)29-15-9-10-16-36-26(28)34/h7-9,11-12,14-15,17,19-20,23H,10,13,16H2,1-6H3,(H2,28,34)(H,29,32)(H,30,31)/b11-7-,12-8-,15-9-,18-17+/t19-,20-,23+/m0/s1 |
| InChIKey | ZKNVQJKBPWZZDL-PZZXIKGESA-N |
| XLogP | 3.17 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|