C23H30FN7O — CID 16662805
1-[4-[(4-fluorophenyl)methyl-methylamino]butyl]-3-[3-(1-propan-2-yltetrazol-5-yl)phenyl]urea (PubChem CID 16662805) has the molecular formula C23H30FN7O and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methyl-methylamino]butyl]-3-[3-(1-propan-2-yltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[4-[(4-fluorophenyl)methyl-methylamino]butyl]-3-[3-(1-propan-2-yltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 16662805 |
| Molecular Formula | C23H30FN7O |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methyl-methylamino]butyl]-3-[3-(1-propan-2-yltetrazol-5-yl)phenyl]urea |
| SMILES | CC(C)n1nnnc1-c1cccc(NC(=O)NCCCCN(C)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H30FN7O/c1-17(2)31-22(27-28-29-31)19-7-6-8-21(15-19)26-23(32)25-13-4-5-14-30(3)16-18-9-11-20(24)12-10-18/h6-12,15,17H,4-5,13-14,16H2,1-3H3,(H2,25,26,32) |
| InChIKey | FQXYZHASORAUFI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|